C24H24N4O4S2 — CID 171331898
2-cyano-3-[3-ethoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171331898) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331898 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nc(SC)ns2)ccc1OCCOc1ccccc1C |
| InChI | InChI=1S/C24H24N4O4S2/c1-4-30-21-14-17(13-18(15-25)22(29)26-23-27-24(33-3)28-34-23)9-10-20(21)32-12-11-31-19-8-6-5-7-16(19)2/h5-10,13-14H,4,11-12H2,1-3H3,(H,26,27,28,29) |
| InChIKey | WQGJPTAIATUJTQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|