C23H22N4O6S2 — CID 170916979
(Z)-2-cyano-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170916979) has the molecular formula C23H22N4O6S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916979 |
| Molecular Formula | C23H22N4O6S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (Z)-2-cyano-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C23H22N4O6S2/c1-3-31-20-14-16(9-10-19(20)33-12-11-32-18-7-5-4-6-8-18)13-17(15-24)21(28)25-22-26-23(27-34-22)35(2,29)30/h4-10,13-14H,3,11-12H2,1-2H3,(H,25,26,27,28)/b17-13- |
| InChIKey | JSMDBLPYESAURZ-LGMDPLHJSA-N |
| XLogP | 3.34 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|