C23H22N4O7S2 — CID 170917075
(Z)-2-cyano-3-[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170917075) has the molecular formula C23H22N4O7S2 and a molecular weight of 530.58 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917075 |
| Molecular Formula | C23H22N4O7S2 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | (Z)-2-cyano-3-[3-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1cccc(OCCOc2ccc(/C=C(/C#N)C(=O)Nc3nc(S(C)(=O)=O)ns3)cc2OC)c1 |
| InChI | InChI=1S/C23H22N4O7S2/c1-31-17-5-4-6-18(13-17)33-9-10-34-19-8-7-15(12-20(19)32-2)11-16(14-24)21(28)25-22-26-23(27-35-22)36(3,29)30/h4-8,11-13H,9-10H2,1-3H3,(H,25,26,27,28)/b16-11- |
| InChIKey | NUIWBDFZSRABJP-WJDWOHSUSA-N |
| XLogP | 2.96 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|