C21H17ClN4O5S2 — CID 170918125
(Z)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170918125) has the molecular formula C21H17ClN4O5S2 and a molecular weight of 504.98 g/mol. Its IUPAC name is (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918125 |
| Molecular Formula | C21H17ClN4O5S2 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN4O5S2/c1-30-18-10-14(5-8-17(18)31-12-13-3-6-16(22)7-4-13)9-15(11-23)19(27)24-20-25-21(26-32-20)33(2,28)29/h3-10H,12H2,1-2H3,(H,24,25,26,27)/b15-9- |
| InChIKey | JCOKSOFQVCMCTG-DHDCSXOGSA-N |
| XLogP | 3.73 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|