C24H23FN4O5S2 — CID 170911839
(Z)-2-cyano-3-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide (PubChem CID 170911839) has the molecular formula C24H23FN4O5S2 and a molecular weight of 530.60 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170911839 |
| Molecular Formula | C24H23FN4O5S2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nc(S(=O)(=O)CC(C)C)ns2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN4O5S2/c1-15(2)14-36(31,32)24-28-23(35-29-24)27-22(30)18(12-26)10-17-6-9-20(21(11-17)33-3)34-13-16-4-7-19(25)8-5-16/h4-11,15H,13-14H2,1-3H3,(H,27,28,29,30)/b18-10- |
| InChIKey | HYHHQTRLOWDZEL-ZDLGFXPLSA-N |
| XLogP | 4.24 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|