C20H14Cl2N4O4S2 — CID 171332246
3-[3-chloro-4-[(4-chlorophenyl)methoxy]phenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332246) has the molecular formula C20H14Cl2N4O4S2 and a molecular weight of 509.40 g/mol. Its IUPAC name is 3-[3-chloro-4-[(4-chlorophenyl)methoxy]phenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 3-[3-chloro-4-[(4-chlorophenyl)methoxy]phenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332246 |
| Molecular Formula | C20H14Cl2N4O4S2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 3-[3-chloro-4-[(4-chlorophenyl)methoxy]phenyl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nsc(NC(=O)C(C#N)=Cc2ccc(OCc3ccc(Cl)cc3)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H14Cl2N4O4S2/c1-32(28,29)20-25-19(31-26-20)24-18(27)14(10-23)8-13-4-7-17(16(22)9-13)30-11-12-2-5-15(21)6-3-12/h2-9H,11H2,1H3,(H,24,25,26,27) |
| InChIKey | XQPGWCSABUYEKN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|