C21H16ClFN4O4S2 — CID 170911057
(Z)-3-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170911057) has the molecular formula C21H16ClFN4O4S2 and a molecular weight of 506.97 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911057 |
| Molecular Formula | C21H16ClFN4O4S2 |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | (Z)-3-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(OCc3ccccc3F)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H16ClFN4O4S2/c1-2-33(29,30)21-26-20(32-27-21)25-19(28)15(11-24)9-13-7-8-18(16(22)10-13)31-12-14-5-3-4-6-17(14)23/h3-10H,2,12H2,1H3,(H,25,26,27,28)/b15-9- |
| InChIKey | RGIMMWHICYWINV-DHDCSXOGSA-N |
| XLogP | 4.25 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|