C20H16N4O7S2 — CID 170910899
[4-[(Z)-2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 170910899) has the molecular formula C20H16N4O7S2 and a molecular weight of 488.50 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 170910899 |
| Molecular Formula | C20H16N4O7S2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(OC(=O)c3ccco3)c(OC)c2)n1 |
| InChI | InChI=1S/C20H16N4O7S2/c1-3-33(27,28)20-23-19(32-24-20)22-17(25)13(11-21)9-12-6-7-14(16(10-12)29-2)31-18(26)15-5-4-8-30-15/h4-10H,3H2,1-2H3,(H,22,23,24,25)/b13-9- |
| InChIKey | CFXCUTSEJRVDHP-LCYFTJDESA-N |
| XLogP | 2.70 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|