C23H22N4O5S2 — CID 171331955
[4-[2-cyano-3-[[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 171331955) has the molecular formula C23H22N4O5S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is [4-[2-cyano-3-[[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[2-cyano-3-[[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 171331955 |
| Molecular Formula | C23H22N4O5S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | [4-[2-cyano-3-[[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nc(SCC(C)C)ns2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C23H22N4O5S2/c1-4-30-19-11-15(7-8-17(19)32-21(29)18-6-5-9-31-18)10-16(12-24)20(28)25-22-26-23(27-34-22)33-13-14(2)3/h5-11,14H,4,13H2,1-3H3,(H,25,26,27,28) |
| InChIKey | CTXWGKIAFMUXQD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|