C16H16N4O2S2 — CID 171331852
2-cyano-3-(4-hydroxyphenyl)-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide (PubChem CID 171331852) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-cyano-3-(4-hydroxyphenyl)-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-(4-hydroxyphenyl)-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171331852 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-cyano-3-(4-hydroxyphenyl)-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
| SMILES | CC(C)CSc1nsc(NC(=O)C(C#N)=Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C16H16N4O2S2/c1-10(2)9-23-16-19-15(24-20-16)18-14(22)12(8-17)7-11-3-5-13(21)6-4-11/h3-7,10,21H,9H2,1-2H3,(H,18,19,20,22) |
| InChIKey | MCDAXRSBTOWDEO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|