C24H20N4O2S3 — CID 170918916
(Z)-2-cyano-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide (PubChem CID 170918916) has the molecular formula C24H20N4O2S3 and a molecular weight of 492.65 g/mol. Its IUPAC name is (Z)-2-cyano-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918916 |
| Molecular Formula | C24H20N4O2S3 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (Z)-2-cyano-N-[3-(2-methylpropylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide |
| SMILES | CC(C)CSc1nsc(NC(=O)/C(C#N)=C\c2ccc(Sc3cccc4ccccc34)o2)n1 |
| InChI | InChI=1S/C24H20N4O2S3/c1-15(2)14-31-24-27-23(33-28-24)26-22(29)17(13-25)12-18-10-11-21(30-18)32-20-9-5-7-16-6-3-4-8-19(16)20/h3-12,15H,14H2,1-2H3,(H,26,27,28,29)/b17-12- |
| InChIKey | PWMQYPSWUSXJQT-ATVHPVEESA-N |
| XLogP | 6.73 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|