C28H20N4O3S2 — CID 171333520
2-cyano-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide (PubChem CID 171333520) has the molecular formula C28H20N4O3S2 and a molecular weight of 524.63 g/mol. Its IUPAC name is 2-cyano-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333520 |
| Molecular Formula | C28H20N4O3S2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 2-cyano-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-(5-naphthalen-1-ylsulfanylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1cccc(OCc2nnc(NC(=O)C(C#N)=Cc3ccc(Sc4cccc5ccccc45)o3)s2)c1 |
| InChI | InChI=1S/C28H20N4O3S2/c1-18-6-4-9-21(14-18)34-17-25-31-32-28(37-25)30-27(33)20(16-29)15-22-12-13-26(35-22)36-24-11-5-8-19-7-2-3-10-23(19)24/h2-15H,17H2,1H3,(H,30,32,33) |
| InChIKey | VVAZAOKJKVPFCY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|