C26H21N5O6S — CID 171333522
2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171333522) has the molecular formula C26H21N5O6S and a molecular weight of 531.55 g/mol. Its IUPAC name is 2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333522 |
| Molecular Formula | C26H21N5O6S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]-N-[5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1ccc(-c2ccc(C=C(C#N)C(=O)Nc3nnc(COc4cccc(C)c4)s3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21N5O6S/c1-3-35-19-7-9-21(22(13-19)31(33)34)23-10-8-20(37-23)12-17(14-27)25(32)28-26-30-29-24(38-26)15-36-18-6-4-5-16(2)11-18/h4-13H,3,15H2,1-2H3,(H,28,30,32) |
| InChIKey | HPQBOHWIVVDWOA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 153.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|