C25H19N5O5S2 — CID 170918463
(Z)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 170918463) has the molecular formula C25H19N5O5S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is (Z)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918463 |
| Molecular Formula | C25H19N5O5S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (Z)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[5-(4-ethoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCOc1ccc(-c2ccc(/C=C(/C#N)C(=O)Nc3nnc(SCc4ccccc4)s3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19N5O5S2/c1-2-34-18-8-10-20(21(13-18)30(32)33)22-11-9-19(35-22)12-17(14-26)23(31)27-24-28-29-25(37-24)36-15-16-6-4-3-5-7-16/h3-13H,2,15H2,1H3,(H,27,28,31)/b17-12- |
| InChIKey | HAGUKOTVPAOQFR-ATVHPVEESA-N |
| XLogP | 5.94 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|