C19H16N4O4S3 — CID 171333596
3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171333596) has the molecular formula C19H16N4O4S3 and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333596 |
| Molecular Formula | C19H16N4O4S3 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nnc(NC(=O)C(C#N)=Cc2ccc(SCc3ccccc3)o2)s1 |
| InChI | InChI=1S/C19H16N4O4S3/c1-2-30(25,26)19-23-22-18(29-19)21-17(24)14(11-20)10-15-8-9-16(27-15)28-12-13-6-4-3-5-7-13/h3-10H,2,12H2,1H3,(H,21,22,24) |
| InChIKey | KRWAAAFRSUNLAN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|