C18H13ClN4O4S3 — CID 170910483
(Z)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170910483) has the molecular formula C18H13ClN4O4S3 and a molecular weight of 480.98 g/mol. Its IUPAC name is (Z)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910483 |
| Molecular Formula | C18H13ClN4O4S3 |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | (Z)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nnc(NC(=O)/C(C#N)=C\c2ccc(SCc3ccc(Cl)cc3)o2)s1 |
| InChI | InChI=1S/C18H13ClN4O4S3/c1-30(25,26)18-23-22-17(29-18)21-16(24)12(9-20)8-14-6-7-15(27-14)28-10-11-2-4-13(19)5-3-11/h2-8H,10H2,1H3,(H,21,22,24)/b12-8- |
| InChIKey | NLLKQQIEJZNGMR-WQLSENKSSA-N |
| XLogP | 4.03 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|