C18H14N4O4S3 — CID 170910482
(Z)-3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170910482) has the molecular formula C18H14N4O4S3 and a molecular weight of 446.54 g/mol. Its IUPAC name is (Z)-3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910482 |
| Molecular Formula | C18H14N4O4S3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | (Z)-3-(5-benzylsulfanylfuran-2-yl)-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(SCc3ccccc3)o2)n1 |
| InChI | InChI=1S/C18H14N4O4S3/c1-29(24,25)18-21-17(28-22-18)20-16(23)13(10-19)9-14-7-8-15(26-14)27-11-12-5-3-2-4-6-12/h2-9H,11H2,1H3,(H,20,21,22,23)/b13-9- |
| InChIKey | YXLFMLMQIFPHNO-LCYFTJDESA-N |
| XLogP | 3.37 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|