C22H15N3O2S2 — CID 46257307
(E)-N-(1,3-benzothiazol-2-yl)-3-(5-benzylsulfanylfuran-2-yl)-2-cyanoprop-2-enamide (PubChem CID 46257307) has the molecular formula C22H15N3O2S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(5-benzylsulfanylfuran-2-yl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(5-benzylsulfanylfuran-2-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 46257307 |
| Molecular Formula | C22H15N3O2S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(5-benzylsulfanylfuran-2-yl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(SCc2ccccc2)o1)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H15N3O2S2/c23-13-16(21(26)25-22-24-18-8-4-5-9-19(18)29-22)12-17-10-11-20(27-17)28-14-15-6-2-1-3-7-15/h1-12H,14H2,(H,24,25,26)/b16-12+ |
| InChIKey | PVWQPMYFWPRKIL-FOWTUZBSSA-N |
| XLogP | 5.73 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|