C21H13N3O2S2 — CID 126000497
(E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 126000497) has the molecular formula C21H13N3O2S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126000497 |
| Molecular Formula | C21H13N3O2S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Sc2nc3ccccc3s2)o1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H13N3O2S2/c22-13-14(20(25)23-15-6-2-1-3-7-15)12-16-10-11-19(26-16)28-21-24-17-8-4-5-9-18(17)27-21/h1-12H,(H,23,25)/b14-12+ |
| InChIKey | XPIWJXHEOXQHCZ-WYMLVPIESA-N |
| XLogP | 5.59 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|