C19H15N5O2S — CID 126152982
(E)-2-cyano-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]-N-pyridin-3-ylprop-2-enamide (PubChem CID 126152982) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 126152982 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (E)-2-cyano-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]-N-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(/C=C(\C#N)C(=O)Nc3cccnc3)o2)n1 |
| InChI | InChI=1S/C19H15N5O2S/c1-12-8-13(2)23-19(22-12)27-17-6-5-16(26-17)9-14(10-20)18(25)24-15-4-3-7-21-11-15/h3-9,11H,1-2H3,(H,24,25)/b14-9+ |
| InChIKey | VKHOQFKQVXTLHX-NTEUORMPSA-N |
| XLogP | 3.78 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|