C22H20N4O2S — CID 1021385
2-cyano-N-(2,5-dimethylphenyl)-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]prop-2-enamide (PubChem CID 1021385) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dimethylphenyl)-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2,5-dimethylphenyl)-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1021385 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-cyano-N-(2,5-dimethylphenyl)-3-[5-(4,6-dimethylpyrimidin-2-yl)sulfanylfuran-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C#N)=Cc2ccc(Sc3nc(C)cc(C)n3)o2)c1 |
| InChI | InChI=1S/C22H20N4O2S/c1-13-5-6-14(2)19(9-13)26-21(27)17(12-23)11-18-7-8-20(28-18)29-22-24-15(3)10-16(4)25-22/h5-11H,1-4H3,(H,26,27) |
| InChIKey | LFXVLJXJXNQLSS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|