C20H15BrN4O2S — CID 126279256
(E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 126279256) has the molecular formula C20H15BrN4O2S and a molecular weight of 455.34 g/mol. Its IUPAC name is (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126279256 |
| Molecular Formula | C20H15BrN4O2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)c(Sc3nccc(C)n3)o2)cc1 |
| InChI | InChI=1S/C20H15BrN4O2S/c1-12-3-5-15(6-4-12)25-18(26)14(11-22)9-16-10-17(21)19(27-16)28-20-23-8-7-13(2)24-20/h3-10H,1-2H3,(H,25,26)/b14-9+ |
| InChIKey | PQZITRKEMOKMHD-NTEUORMPSA-N |
| XLogP | 5.15 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|