C18H12BrN5O2S — CID 126282681
(E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-pyridin-3-ylprop-2-enamide (PubChem CID 126282681) has the molecular formula C18H12BrN5O2S and a molecular weight of 442.30 g/mol. Its IUPAC name is (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 126282681 |
| Molecular Formula | C18H12BrN5O2S |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | (E)-3-[4-bromo-5-(4-methylpyrimidin-2-yl)sulfanylfuran-2-yl]-2-cyano-N-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccnc(Sc2oc(/C=C(\C#N)C(=O)Nc3cccnc3)cc2Br)n1 |
| InChI | InChI=1S/C18H12BrN5O2S/c1-11-4-6-22-18(23-11)27-17-15(19)8-14(26-17)7-12(9-20)16(25)24-13-3-2-5-21-10-13/h2-8,10H,1H3,(H,24,25)/b12-7+ |
| InChIKey | SDIDSDNDKMNGBV-KPKJPENVSA-N |
| XLogP | 4.23 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|