C15H9Cl2N3O — CID 112979270
(E)-2-cyano-3-(2,4-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide (PubChem CID 112979270) has the molecular formula C15H9Cl2N3O and a molecular weight of 318.16 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,4-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,4-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 112979270 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (E)-2-cyano-3-(2,4-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1Cl)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C15H9Cl2N3O/c16-12-4-3-10(14(17)7-12)6-11(8-18)15(21)20-13-2-1-5-19-9-13/h1-7,9H,(H,20,21)/b11-6+ |
| InChIKey | OZNDYBWLGKEJRY-IZZDOVSWSA-N |
| XLogP | 3.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|