C23H15ClN4O2 — CID 126150937
(E)-3-[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]-2-cyano-N-pyridin-3-ylprop-2-enamide (PubChem CID 126150937) has the molecular formula C23H15ClN4O2 and a molecular weight of 414.85 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]-2-cyano-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]-2-cyano-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 126150937 |
| Molecular Formula | C23H15ClN4O2 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (E)-3-[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]-2-cyano-N-pyridin-3-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)ccc1OCc1ccc(C#N)cc1)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C23H15ClN4O2/c24-20-7-8-22(30-15-17-5-3-16(12-25)4-6-17)18(11-20)10-19(13-26)23(29)28-21-2-1-9-27-14-21/h1-11,14H,15H2,(H,28,29)/b19-10+ |
| InChIKey | YUICWBMBJNXTRU-VXLYETTFSA-N |
| XLogP | 4.73 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|