C23H15Br2ClN2O2 — CID 124540871
(E)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 124540871) has the molecular formula C23H15Br2ClN2O2 and a molecular weight of 546.65 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 124540871 |
| Molecular Formula | C23H15Br2ClN2O2 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | (E)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCc1ccc(Br)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Br2ClN2O2/c24-18-6-4-15(5-7-18)14-30-22-9-8-19(25)11-16(22)10-17(13-27)23(29)28-21-3-1-2-20(26)12-21/h1-12H,14H2,(H,28,29)/b17-10+ |
| InChIKey | ULVNPAJTZAKUEE-LICLKQGHSA-N |
| XLogP | 6.99 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|