C24H26BrClN2O2 — CID 3892722
3-(5-bromo-2-octoxyphenyl)-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 3892722) has the molecular formula C24H26BrClN2O2 and a molecular weight of 489.84 g/mol. Its IUPAC name is 3-(5-bromo-2-octoxyphenyl)-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3-(5-bromo-2-octoxyphenyl)-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 3892722 |
| Molecular Formula | C24H26BrClN2O2 |
| Molecular Weight | 489.84 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 3-(5-bromo-2-octoxyphenyl)-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCCCCCOc1ccc(Br)cc1C=C(C#N)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26BrClN2O2/c1-2-3-4-5-6-7-13-30-23-12-11-20(25)15-18(23)14-19(17-27)24(29)28-22-10-8-9-21(26)16-22/h8-12,14-16H,2-7,13H2,1H3,(H,28,29) |
| InChIKey | XITNDAGPSUGHBI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.84 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|