C25H29ClN2O2 — CID 4009281
3-(5-chloro-2-octoxyphenyl)-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 4009281) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 3-(5-chloro-2-octoxyphenyl)-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | 3-(5-chloro-2-octoxyphenyl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4009281 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-(5-chloro-2-octoxyphenyl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | CCCCCCCCOc1ccc(Cl)cc1C=C(C#N)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H29ClN2O2/c1-3-4-5-6-7-8-14-30-24-13-12-22(26)17-20(24)16-21(18-27)25(29)28-23-11-9-10-19(2)15-23/h9-13,15-17H,3-8,14H2,1-2H3,(H,28,29) |
| InChIKey | MAOBLNQTYUVCLJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|