C24H18Cl2N2O2 — CID 94851322
(E)-2-cyano-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide (PubChem CID 94851322) has the molecular formula C24H18Cl2N2O2 and a molecular weight of 437.33 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94851322 |
| Molecular Formula | C24H18Cl2N2O2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (E)-2-cyano-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C/c2ccccc2OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C24H18Cl2N2O2/c1-16-5-4-7-21(11-16)28-24(29)19(14-27)12-17-6-2-3-8-23(17)30-15-18-9-10-20(25)13-22(18)26/h2-13H,15H2,1H3,(H,28,29)/b19-12+ |
| InChIKey | NAIOKMBAAZGYPE-XDHOZWIPSA-N |
| XLogP | 6.43 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|