C24H16BrCl3N2O2 — CID 124541706
(Z)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 124541706) has the molecular formula C24H16BrCl3N2O2 and a molecular weight of 550.67 g/mol. Its IUPAC name is (Z)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 124541706 |
| Molecular Formula | C24H16BrCl3N2O2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 547.95 |
| IUPAC Name | (Z)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C\c1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H16BrCl3N2O2/c1-14-20(27)3-2-4-22(14)30-24(31)17(12-29)9-16-10-18(25)6-8-23(16)32-13-15-5-7-19(26)11-21(15)28/h2-11H,13H2,1H3,(H,30,31)/b17-9- |
| InChIKey | SXSWADYAAARHTL-MFOYZWKCSA-N |
| XLogP | 7.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|