C26H18Cl3N3O — CID 124646628
(Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 124646628) has the molecular formula C26H18Cl3N3O and a molecular weight of 494.81 g/mol. Its IUPAC name is (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 124646628 |
| Molecular Formula | C26H18Cl3N3O |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C26H18Cl3N3O/c1-16-22(28)6-4-7-24(16)31-26(33)18(13-30)11-19-15-32(25-8-3-2-5-21(19)25)14-17-9-10-20(27)12-23(17)29/h2-12,15H,14H2,1H3,(H,31,33)/b18-11- |
| InChIKey | NSTBNSYUDSYDGZ-WQRHYEAKSA-N |
| XLogP | 7.50 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|