C21H15ClN4O — CID 126382305
(Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]prop-2-enamide (PubChem CID 126382305) has the molecular formula C21H15ClN4O and a molecular weight of 374.83 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126382305 |
| Molecular Formula | C21H15ClN4O |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C(C#N)=C\c1cn(CC#N)c2ccccc12 |
| InChI | InChI=1S/C21H15ClN4O/c1-14-6-7-17(22)11-19(14)25-21(27)15(12-24)10-16-13-26(9-8-23)20-5-3-2-4-18(16)20/h2-7,10-11,13H,9H2,1H3,(H,25,27)/b15-10- |
| InChIKey | JEZOSMBFXJCWRB-GDNBJRDFSA-N |
| XLogP | 4.67 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|