C27H21Cl2N3O — CID 2722355
(E)-2-cyano-3-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 2722355) has the molecular formula C27H21Cl2N3O and a molecular weight of 474.39 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2722355 |
| Molecular Formula | C27H21Cl2N3O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (E)-2-cyano-3-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C27H21Cl2N3O/c1-17-7-10-25(18(2)11-17)31-27(33)20(14-30)13-21-16-32(26-6-4-3-5-22(21)26)15-19-8-9-23(28)24(29)12-19/h3-13,16H,15H2,1-2H3,(H,31,33)/b20-13+ |
| InChIKey | QLMLXHITTQHDAP-DEDYPNTBSA-N |
| XLogP | 7.16 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|