C23H19N5OS — CID 170910780
(Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170910780) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910780 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(Cn2cc(/C=C(/C#N)C(=O)Nc3nnc(C)s3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N5OS/c1-15-7-9-17(10-8-15)13-28-14-19(20-5-3-4-6-21(20)28)11-18(12-24)22(29)25-23-27-26-16(2)30-23/h3-11,14H,13H2,1-2H3,(H,25,27,29)/b18-11- |
| InChIKey | JBRSSZCFMMSGOB-WQRHYEAKSA-N |
| XLogP | 4.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|