C26H21N3O — CID 1352689
(E)-2-cyano-3-[1-[(3-methylphenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide (PubChem CID 1352689) has the molecular formula C26H21N3O and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[(3-methylphenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[(3-methylphenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1352689 |
| Molecular Formula | C26H21N3O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (E)-2-cyano-3-[1-[(3-methylphenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide |
| SMILES | Cc1cccc(Cn2cc(/C=C(\C#N)C(=O)Nc3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H21N3O/c1-19-8-7-9-20(14-19)17-29-18-22(24-12-5-6-13-25(24)29)15-21(16-27)26(30)28-23-10-3-2-4-11-23/h2-15,18H,17H2,1H3,(H,28,30)/b21-15+ |
| InChIKey | QYCJJUSDKFVAJW-RCCKNPSSSA-N |
| XLogP | 5.54 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|