C28H25N3O2 — CID 3769070
2-cyano-N-(3-ethoxyphenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 3769070) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-cyano-N-(3-ethoxyphenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-ethoxyphenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3769070 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-cyano-N-(3-ethoxyphenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | CCOc1cccc(NC(=O)C(C#N)=Cc2cn(Cc3cccc(C)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C28H25N3O2/c1-3-33-25-11-7-10-24(16-25)30-28(32)22(17-29)15-23-19-31(27-13-5-4-12-26(23)27)18-21-9-6-8-20(2)14-21/h4-16,19H,3,18H2,1-2H3,(H,30,32) |
| InChIKey | FUAKGAWOGOKCSR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|