C26H18N3O3- — CID 2379378
3-[[(Z)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 2379378) has the molecular formula C26H18N3O3- and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-[[(Z)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | 3-[[(Z)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2379378 |
| Molecular Formula | C26H18N3O3- |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[[(Z)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | N#C/C(=C/c1cn(Cc2ccccc2)c2ccccc12)C(=O)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C26H19N3O3/c27-15-20(25(30)28-22-10-6-9-19(14-22)26(31)32)13-21-17-29(16-18-7-2-1-3-8-18)24-12-5-4-11-23(21)24/h1-14,17H,16H2,(H,28,30)(H,31,32)/p-1/b20-13- |
| InChIKey | FWOFTQXVMXECFM-MOSHPQCFSA-M |
| XLogP | 3.60 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|