C20H14N3O3- — CID 7328638
2-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetate (PubChem CID 7328638) has the molecular formula C20H14N3O3- and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetate.
| Compound Name | 2-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 7328638 |
| Molecular Formula | C20H14N3O3- |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetate |
| SMILES | N#C/C(=C\c1cn(CC(=O)[O-])c2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H15N3O3/c21-11-14(20(26)22-16-6-2-1-3-7-16)10-15-12-23(13-19(24)25)18-9-5-4-8-17(15)18/h1-10,12H,13H2,(H,22,26)(H,24,25)/p-1/b14-10+ |
| InChIKey | FNCNQQRAGRUAGW-GXDHUFHOSA-M |
| XLogP | 1.94 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|