C22H13F6N3O3 — CID 73048663
2-[3-[3-[3,5-bis(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 73048663) has the molecular formula C22H13F6N3O3 and a molecular weight of 481.35 g/mol. Its IUPAC name is 2-[3-[3-[3,5-bis(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[3-[3,5-bis(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 73048663 |
| Molecular Formula | C22H13F6N3O3 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-[3-[3-[3,5-bis(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#CC(=Cc1cn(CC(=O)O)c2ccccc12)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H13F6N3O3/c23-21(24,25)14-6-15(22(26,27)28)8-16(7-14)30-20(34)12(9-29)5-13-10-31(11-19(32)33)18-4-2-1-3-17(13)18/h1-8,10H,11H2,(H,30,34)(H,32,33) |
| InChIKey | DCQWHZDJPCHZBX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|