C26H17ClF3N3O — CID 126238163
(Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126238163) has the molecular formula C26H17ClF3N3O and a molecular weight of 479.89 g/mol. Its IUPAC name is (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126238163 |
| Molecular Formula | C26H17ClF3N3O |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(Cc2ccc(Cl)cc2)c2ccccc12)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17ClF3N3O/c27-21-10-8-17(9-11-21)15-33-16-19(23-6-1-2-7-24(23)33)12-18(14-31)25(34)32-22-5-3-4-20(13-22)26(28,29)30/h1-13,16H,15H2,(H,32,34)/b18-12- |
| InChIKey | MEAJEDJWODIFSC-PDGQHHTCSA-N |
| XLogP | 6.91 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|