C21H14ClN3O — CID 1070409
(E)-N-(4-chlorophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide (PubChem CID 1070409) has the molecular formula C21H14ClN3O and a molecular weight of 359.82 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1070409 |
| Molecular Formula | C21H14ClN3O |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
| SMILES | C#CCn1cc(/C=C(\C#N)C(=O)Nc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C21H14ClN3O/c1-2-11-25-14-16(19-5-3-4-6-20(19)25)12-15(13-23)21(26)24-18-9-7-17(22)8-10-18/h1,3-10,12,14H,11H2,(H,24,26)/b15-12+ |
| InChIKey | KEJMXWAMYGJPBA-NTCAYCPXSA-N |
| XLogP | 4.47 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|