C25H19ClN4O3 — CID 1140614
(E)-N-(4-chlorophenyl)-2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]prop-2-enamide (PubChem CID 1140614) has the molecular formula C25H19ClN4O3 and a molecular weight of 458.91 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1140614 |
| Molecular Formula | C25H19ClN4O3 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)NCc2ccco2)c2ccccc12)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN4O3/c26-19-7-9-20(10-8-19)29-25(32)17(13-27)12-18-15-30(23-6-2-1-5-22(18)23)16-24(31)28-14-21-4-3-11-33-21/h1-12,15H,14,16H2,(H,28,31)(H,29,32)/b17-12+ |
| InChIKey | NGIFMDMRGVVPLH-SFQUDFHCSA-N |
| XLogP | 4.75 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|