C22H22N4O4 — CID 3143635
2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 3143635) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3143635 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-cyano-3-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]indol-3-yl]-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | COCCNC(=O)C(C#N)=Cc1cn(CC(=O)NCc2ccco2)c2ccccc12 |
| InChI | InChI=1S/C22H22N4O4/c1-29-10-8-24-22(28)16(12-23)11-17-14-26(20-7-3-2-6-19(17)20)15-21(27)25-13-18-5-4-9-30-18/h2-7,9,11,14H,8,10,13,15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | RNFJEQIACXIKBK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|