C23H22N4O3 — CID 1140649
2-[3-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 1140649) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1140649 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)NCc2ccco2)c2ccccc12)C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H22N4O3/c24-13-17(23(29)26-9-3-4-10-26)12-18-15-27(21-8-2-1-7-20(18)21)16-22(28)25-14-19-6-5-11-30-19/h1-2,5-8,11-12,15H,3-4,9-10,14,16H2,(H,25,28)/b17-12+ |
| InChIKey | YHKDGYPNDHRVTC-SFQUDFHCSA-N |
| XLogP | 3.08 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|