C23H27N3O3S — CID 20902600
2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide (PubChem CID 20902600) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 20902600 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1cn(CC(=O)N2CCCCCC2)c2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C23H27N3O3S/c27-22(24-14-18-8-7-13-29-18)17-30-21-15-26(20-10-4-3-9-19(20)21)16-23(28)25-11-5-1-2-6-12-25/h3-4,7-10,13,15H,1-2,5-6,11-12,14,16-17H2,(H,24,27) |
| InChIKey | XGBHWKYCCHAXKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |