C22H22FN3O2S — CID 20902403
N-(2-fluorophenyl)-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]sulfanylacetamide (PubChem CID 20902403) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]sulfanylacetamide.
| Compound Name | N-(2-fluorophenyl)-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 20902403 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-(2-fluorophenyl)-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1cn(CC(=O)N2CCCC2)c2ccccc12)Nc1ccccc1F |
| InChI | InChI=1S/C22H22FN3O2S/c23-17-8-2-3-9-18(17)24-21(27)15-29-20-13-26(19-10-4-1-7-16(19)20)14-22(28)25-11-5-6-12-25/h1-4,7-10,13H,5-6,11-12,14-15H2,(H,24,27) |
| InChIKey | CYGPTDRTAAQUKC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |