C21H18N2O4S — CID 16935380
2-[3-(benzenesulfonyl)indol-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 16935380) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)indol-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 16935380 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccccc2)c2ccccc21)NCc1ccco1 |
| InChI | InChI=1S/C21H18N2O4S/c24-21(22-13-16-7-6-12-27-16)15-23-14-20(18-10-4-5-11-19(18)23)28(25,26)17-8-2-1-3-9-17/h1-12,14H,13,15H2,(H,22,24) |
| InChIKey | SQJKIBQUODQGQW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |