About 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide
2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide (PubChem CID 16841490) has the molecular formula C30H26N2O3S
and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide.
Molecular Properties
| Compound Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide |
| PubChem CID | 16841490 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccccc2)c2ccccc21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H26N2O3S/c33-30(32(20-24-12-4-1-5-13-24)21-25-14-6-2-7-15-25)23-31-22-29(27-18-10-11-19-28(27)31)36(34,35)26-16-8-3-9-17-26/h1-19,22H,20-21,23H2 |
| InChIKey | AHLDVRNNYSFIJR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide?
The IUPAC name of 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide (CID 16841490) is 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide.
What is the SMILES notation for 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide?
The canonical SMILES for 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide is O=C(Cn1cc(S(=O)(=O)c2ccccc2)c2ccccc21)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide?
The InChIKey is AHLDVRNNYSFIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26N2O3S/c33-30(32(20-24-12-4-1-5-13-24)21-25-14-6-2-7-15-25)23-31-22-29(27-18-10-11-19-28(27)31)36(34,35)26-16-8-3-9-17-26/h1-19,22H,20-21,23H2.
What are the key properties of 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide?
2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide has a molecular weight of 494.62 g/mol, XLogP of 5.70, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(benzenesulfonyl)indol-1-yl]-N,N-dibenzylacetamide is sourced from PubChem (CID 16841490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).