C23H26N2O3S — CID 16935293
2-[3-(benzenesulfonyl)indol-1-yl]-N-cyclohexyl-N-methylacetamide (PubChem CID 16935293) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)indol-1-yl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 16935293 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)Cn1cc(S(=O)(=O)c2ccccc2)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C23H26N2O3S/c1-24(18-10-4-2-5-11-18)23(26)17-25-16-22(20-14-8-9-15-21(20)25)29(27,28)19-12-6-3-7-13-19/h3,6-9,12-16,18H,2,4-5,10-11,17H2,1H3 |
| InChIKey | KVBXZZYOSXSRCV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |