C24H27ClN2O3S — CID 20911230
2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]-N-cyclohexyl-N-methylacetamide (PubChem CID 20911230) has the molecular formula C24H27ClN2O3S and a molecular weight of 459.01 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 20911230 |
| Molecular Formula | C24H27ClN2O3S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)Cn1cc(S(=O)(=O)Cc2cccc(Cl)c2)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C24H27ClN2O3S/c1-26(20-10-3-2-4-11-20)24(28)16-27-15-23(21-12-5-6-13-22(21)27)31(29,30)17-18-8-7-9-19(25)14-18/h5-9,12-15,20H,2-4,10-11,16-17H2,1H3 |
| InChIKey | SREBYLDZORTBLT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |